1.0 2020-04-17 19:15:05 UTC 2020-11-18 16:39:27 UTC CDB005157 (S)-3-Hydroxyisobutyric acid (S)-3-Hydroxyisobutyric acid, also known as (S)-3-hydroxy-2-methylpropanoate or 3-hydroxy-isobutyrate, belongs to the class of organic compounds known as beta hydroxy acids and derivatives. Beta hydroxy acids and derivatives are compounds containing a carboxylic acid substituted with a hydroxyl group on the C3 carbon atom (S)-3-Hydroxyisobutyric acid is an extremely weak basic (essentially neutral) compound (based on its pKa) (S)-3-Hydroxyisobutyric acid exists in all living species, ranging from bacteria to humans. The severity of this disease varies from case to case (S)-3-hydroxyisobutyric acid can be converted into (S)-methylmalonic acid semialdehyde through its interaction with the enzymes 3-hydroxyisobutyrate dehydrogenase, mitochondrial and enoyl-CoA hydratase, mitochondrial. In humans, (S)-3-hydroxyisobutyric acid is involved in the metabolic disorder called the 2-methyl-3-hydroxybutyryl-coa dehydrogenase deficiency pathway (S)-3-Hydroxyisobutyric acid is an intermediate in the metabolic pathways of L-valine and L-thymine amino acids. The deficient enzyme in 3HiB-uria remains unclear (S)-3-Hydroxyisobutyric acid is a potentially toxic compound (S)-3-Hydroxyisobutyric acid, with regard to humans, has been found to be associated with several diseases such as eosinophilic esophagitis, colorectal cancer, and diabetes mellitus type 2; (S)-3-hydroxyisobutyric acid has also been linked to the inborn metabolic disorder 3-hydroxyisobutyric aciduria. Patients with 3-hydroxyisobutyric aciduria excrete a significant amount of (S)-3-Hydroxyisobutyric acid not only during the acute stage but also when stable. (S)-3-Hydroxyisobutyric acid is expected to be in Cannabis as all living plants are known to produce and metabolize it. (S)-3-Hydroxy-2-methylpropanoic acid (S)-3-Hydroxy-2-methylpropionic acid (S)-3-Hydroxy-2-methylpropanoate (S)-3-Hydroxy-2-methylpropionate (S)-3-Hydroxyisobutyrate 2-Methyl-L-(+)-hydracrylate 2-Methyl-L-(+)-hydracrylic acid 3-Hydroxy(iso)butyric acid 3-Hydroxy-2-methyl-(S)-propanoate 3-Hydroxy-2-methyl-(S)-propanoic acid 3-Hydroxy-2-methylpropanoate 3-Hydroxy-2-methylpropanoic acid 3-Hydroxy-isobutyrate 3-Hydroxyisobutyrate 3-Hydroxyisobutyric acid (2S)-3-Hydroxy-2-methylpropanoic acid (2S)-3-Hydroxy-2-methylpropionic acid (S)-beta-Hydroxyisobutyric acid (S)-Β-hydroxyisobutyric acid (±)-3-hydroxy-2-methylpropanoic acid (±)-3-hydroxy-2-methylpropionic acid 2-(Hydroxymethyl)propanoic acid 2-(Hydroxymethyl)propionic acid 2-Methyl-3-hydroxypropanoic acid 2-Methyl-3-hydroxypropionic acid 3-HIBA 3-Hydroxy-2-methylpropionic acid DL-3-Hydroxyisobutyric acid L-(+)-beta-Hydroxyisobutyric acid L-(+)-Β-hydroxyisobutyric acid beta-Hydroxyisobutyric acid Β-hydroxyisobutyric acid 3-Hydroxy-2-isobutyrate 3-Hydroxy-2-isobutyric acid (S)-3-Hydroxyisobutyric acid C4H8O3 104.1 104.0473 (2S)-3-hydroxy-2-methylpropanoic acid (S)-3-hydroxyisobutyric acid 2068-83-9 C[C@@H](CO)C(O)=O InChI=1S/C4H8O3/c1-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1 DBXBTMSZEOQQDU-VKHMYHEASA-N belongs to the class of organic compounds known as beta hydroxy acids and derivatives. Beta hydroxy acids and derivatives are compounds containing a carboxylic acid substituted with a hydroxyl group on the C3 carbon atom. Beta hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Beta hydroxy acids and derivatives Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Primary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Primary alcohol 3-hydroxyisobutyric acid logp -0.47 ALOGPS logs 0.74 ALOGPS logp -0.26 ChemAxon pka_strongest_acidic 4.37 ChemAxon pka_strongest_basic -2.7 ChemAxon iupac (2S)-3-hydroxy-2-methylpropanoic acid ChemAxon average_mass 104.1 ChemAxon mono_mass 104.0473 ChemAxon smiles C[C@@H](CO)C(O)=O ChemAxon formula C4H8O3 ChemAxon inchi InChI=1S/C4H8O3/c1-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1 ChemAxon inchikey DBXBTMSZEOQQDU-VKHMYHEASA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 23.62 ChemAxon polarizability 9.98 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon 389707 C06001 FDB021877 440873 37373 CPD-12175 37034 483