1.0 2020-04-17 18:38:28 UTC 2020-12-07 19:10:58 UTC CDB004804 Glyoxylic acid Glyoxylic acid, also known as a-ketoacetate or glyoxalate, belongs to the class of organic compounds known as carboxylic acids. Carboxylic acids are compounds containing a carboxylic acid group with the formula -C(=O)OH. Glyoxylic acid is an extremely weak basic (essentially neutral) compound (based on its pKa). A 2-oxo monocarboxylic acid that is acetic acid bearing an oxo group at the alpha carbon atom. Glyoxylic acid exists in all living species, ranging from bacteria to humans. L-alanine and glyoxylic acid can be biosynthesized from glycine and pyruvic acid through its interaction with the enzyme serine--pyruvate aminotransferase. In humans, glyoxylic acid is involved in the metabolic disorder called the dimethylglycine dehydrogenase deficiency pathway. Outside of the human body, Glyoxylic acid has been detected, but not quantified in, tamarinds. This could make glyoxylic acid a potential biomarker for the consumption of these foods. Glyoxylic acid is a potentially toxic compound. Glyoxylic acid, with regard to humans, has been found to be associated with several diseases such as bladder infections and transurethral resection of the prostate; glyoxylic acid has also been linked to the inborn metabolic disorder primary hyperoxaluria I. Glyoxylic acid is expected to be in Cannabis as all living plants are known to produce and metabolize it. alpha-Ketoacetic acid Formylformic acid Glyoxalate Glyoxalsaeure Glyoxylate Glyoxylsaeure Oxalaldehydic acid Oxoethanoic acid a-Ketoacetate a-Ketoacetic acid alpha-Ketoacetate Α-ketoacetate Α-ketoacetic acid Formylformate Glyoxalic acid Oxalaldehydate Oxoethanoate Oxoacetate Oxoacetic acid Glyoxylic acid, 2-(14)C-labeled Glyoxylic acid, sodium salt Glyoxylic acid, sodium salt, 2-(14)C-labeled Glyoxylic acid, 14c2-labeled Glyoxylic acid, calcium salt Glyoxylic acid, sodium salt, 14C-labeled C2H2O3 74.04 74.0004 2-oxoacetic acid glyoxylic acid 298-12-4 OC(=O)C=O InChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) HHLFWLYXYJOTON-UHFFFAOYSA-N belongs to the class of organic compounds known as carboxylic acids. Carboxylic acids are compounds containing a carboxylic acid group with the formula -C(=O)OH. Carboxylic acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Carboxylic acids Aliphatic acyclic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Short-chain aldehydes Aldehyde Aliphatic acyclic compound Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Short-chain aldehyde 2-oxo monocarboxylic acid aldehydic acid melting_point -93 °C boiling_point 111 °C Wikipedia logp -0.59 ALOGPS logs 0.48 ALOGPS logp -0.13 ChemAxon pka_strongest_acidic 2.61 ChemAxon pka_strongest_basic -9.2 ChemAxon iupac 2-oxoacetic acid ChemAxon average_mass 74.04 ChemAxon mono_mass 74.0004 ChemAxon smiles OC(=O)C=O ChemAxon formula C2H2O3 ChemAxon inchi InChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) ChemAxon inchikey HHLFWLYXYJOTON-UHFFFAOYSA-N ChemAxon polar_surface_area 54.37 ChemAxon refractivity 13.5 ChemAxon polarizability 5.35 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon C00048 DB04343 FDB007244 740 760 16891 C00001186 GLYOX Glyoxylic_acid 33659 3213