1.0 2020-04-17 18:36:19 UTC 2020-12-07 19:10:55 UTC CDB004783 alpha-Ketoisovaleric acid alpha-Ketoisovaleric acid, also known as a-keto-isovalerate or 3-methyl-2-oxobutanoate, belongs to the class of organic compounds known as short-chain keto acids and derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms. alpha-Ketoisovaleric acid is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. alpha-Ketoisovaleric acid exists in all living species, ranging from bacteria to humans. alpha-Ketoisovaleric acid is a fruity tasting compound. Outside of the human body, alpha-Ketoisovaleric acid has been detected, but not quantified in, several different foods, such as root vegetables, jerusalem artichokes, rapinis, chia, and cowpea. This could make alpha-ketoisovaleric acid a potential biomarker for the consumption of these foods. alpha-Ketoisovaleric acid is a potentially toxic compound. alpha-Ketoisovaleric acid, with regard to humans, has been found to be associated with the diseases such as colorectal cancer; alpha-ketoisovaleric acid has also been linked to the inborn metabolic disorder maple syrup urine disease. A 2-oxo monocarboxylic acid that is the 2-oxo derivative of isovaleric acid. alpha-Ketoisovaleric acid is expected to be in Cannabis as all living plants are known to produce and metabolize it. 2-Keto-3-methylbutyric acid 2-Ketoisovaleric acid 2-Ketovaline 2-oxo-3-Methylbutanoic acid 2-oxo-3-Methylbutyric acid 2-Oxoisovaleric acid 3-Methyl-2-oxobutanoate 3-Methyl-2-oxobutyric acid alpha-Keto-isovaleric acid alpha-Ketovaline alpha-oxo-beta-Methylbutyricacid alpha-Oxoisovaleric acid Dimethylpyruvic acid Isopropylglyoxylic acid 2-oxo-3-Methylbutanoate 2-Oxoisovalerate 2-Oxoisopentanoate 2-Keto-3-methylbutyrate 2-Ketoisovalerate 2-oxo-3-Methylbutyrate 3-Methyl-2-oxobutanoic acid 3-Methyl-2-oxobutyrate a-Keto-isovalerate a-Keto-isovaleric acid alpha-Keto-isovalerate Α-keto-isovalerate Α-keto-isovaleric acid a-Ketovaline Α-ketovaline a-oxo-b-Methylbutyricacid Α-oxo-β-methylbutyricacid a-Oxoisovalerate a-Oxoisovaleric acid alpha-Oxoisovalerate Α-oxoisovalerate Α-oxoisovaleric acid Dimethylpyruvate Isopropylglyoxylate 2-Oxoisopentanoic acid a-Ketoisovalerate a-Ketoisovaleric acid alpha-Ketoisovalerate Α-ketoisovalerate Α-ketoisovaleric acid 2-Ketoisvaleric acid 2-oxo-3-Methyl-butyrate 3-Methyl-2-oxo-butanoate 3-Methyl-2-oxo-butanoic acid 3-Methyl-2-oxo-butyrate 3-Methyl-2-oxo-butyric acid 3-Methyl-2-oxobutinoate 3-Methyl-2-oxobutinoic acid a-Keto-b-methylbutyrate a-Keto-b-methylbutyric acid a-oxo-b-Methylbutyrate a-oxo-b-Methylbutyric acid alpha-Keto-beta-methylbutyrate alpha-Keto-beta-methylbutyric acid alpha-oxo-beta-Methylbutyrate alpha-oxo-beta-Methylbutyric acid Ketovaline alpha-Ketoisopentanoic acid alpha-Ketoisovaleric acid C5H8O3 116.12 116.0473 3-methyl-2-oxobutanoic acid α-ketoisovalerate 759-05-7 CC(C)C(=O)C(O)=O InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8) QHKABHOOEWYVLI-UHFFFAOYSA-N belongs to the class of organic compounds known as short-chain keto acids and derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms. Short-chain keto acids and derivatives Organic compounds Organic acids and derivatives Keto acids and derivatives Short-chain keto acids and derivatives Aliphatic acyclic compounds Alpha-hydroxy ketones Alpha-keto acids and derivatives Carboxylic acids Hydrocarbon derivatives Methyl-branched fatty acids Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Alpha-hydroxy ketone Alpha-keto acid Branched fatty acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acyl Hydrocarbon derivative Ketone Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Short-chain keto acid 2-oxo monocarboxylic acid Branched fatty acids Branched fatty acids melting_point 31.5 °C logp 0.49 ALOGPS logs -0.59 ALOGPS logp 1.31 ChemAxon pka_strongest_acidic 3.37 ChemAxon pka_strongest_basic -9.7 ChemAxon iupac 3-methyl-2-oxobutanoic acid ChemAxon average_mass 116.12 ChemAxon mono_mass 116.0473 ChemAxon smiles CC(C)C(=O)C(O)=O ChemAxon formula C5H8O3 ChemAxon inchi InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8) ChemAxon inchikey QHKABHOOEWYVLI-UHFFFAOYSA-N ChemAxon polar_surface_area 54.37 ChemAxon refractivity 27.19 ChemAxon polarizability 11.04 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon number_of_rings 0 ChemAxon bioavailability 1 ChemAxon rule_of_five Yes ChemAxon ghose_filter Yes ChemAxon veber_rule Yes ChemAxon mddr_like_rule Yes ChemAxon DB04074 48 49 C00141 FDB012250 16530 2-KETO-ISOVALERATE C00007623 34011 Alpha-Ketoisovaleric acid 5091